C15H13F3N3O4Y- — CID 58858656
ethyl N-[5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-methylbenzene-4-id-1-yl]carbamate;yttrium (PubChem CID 58858656) has the molecular formula C15H13F3N3O4Y- and a molecular weight of 445.19 g/mol. Its IUPAC name is ethyl N-[5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-methylbenzene-4-id-1-yl]carbamate;yttrium.
| Compound Name | ethyl N-[5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-methylbenzene-4-id-1-yl]carbamate;yttrium |
|---|---|
| PubChem CID | 58858656 |
| Molecular Formula | C15H13F3N3O4Y- |
| Molecular Weight | 445.19 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | ethyl N-[5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-methylbenzene-4-id-1-yl]carbamate;yttrium |
| SMILES | CCOC(=O)Nc1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)[c-]cc1C.[Y] |
| InChI | InChI=1S/C15H13F3N3O4.Y/c1-3-25-14(24)19-10-6-9(5-4-8(10)2)21-12(22)7-11(15(16,17)18)20-13(21)23;/h4,6-7H,3H2,1-2H3,(H,19,24)(H,20,23);/q-1; |
| InChIKey | NPEGXSDNIRRJEF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|