C15H12F3N4O6Y- — CID 58858653
ethyl N-[3-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-6-methyl-2-nitrobenzene-4-id-1-yl]carbamate;yttrium (PubChem CID 58858653) has the molecular formula C15H12F3N4O6Y- and a molecular weight of 490.18 g/mol. Its IUPAC name is ethyl N-[3-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-6-methyl-2-nitrobenzene-4-id-1-yl]carbamate;yttrium.
| Compound Name | ethyl N-[3-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-6-methyl-2-nitrobenzene-4-id-1-yl]carbamate;yttrium |
|---|---|
| PubChem CID | 58858653 |
| Molecular Formula | C15H12F3N4O6Y- |
| Molecular Weight | 490.18 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | ethyl N-[3-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-6-methyl-2-nitrobenzene-4-id-1-yl]carbamate;yttrium |
| SMILES | CCOC(=O)Nc1c(C)c[c-]c(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)c1[N+](=O)[O-].[Y] |
| InChI | InChI=1S/C15H12F3N4O6.Y/c1-3-28-14(25)20-11-7(2)4-5-8(12(11)22(26)27)21-10(23)6-9(15(16,17)18)19-13(21)24;/h4,6H,3H2,1-2H3,(H,19,24)(H,20,25);/q-1; |
| InChIKey | SHOASDLQQHAFBE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 136.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|