C17H15N4O2S+ — CID 58859020
[1H-benzimidazol-2-ylmethylsulfanyl-(3-carboxyanilino)methylidene]-methylideneazanium (PubChem CID 58859020) has the molecular formula C17H15N4O2S+ and a molecular weight of 339.40 g/mol. Its IUPAC name is [1H-benzimidazol-2-ylmethylsulfanyl-(3-carboxyanilino)methylidene]-methylideneazanium.
| Compound Name | [1H-benzimidazol-2-ylmethylsulfanyl-(3-carboxyanilino)methylidene]-methylideneazanium |
|---|---|
| PubChem CID | 58859020 |
| Molecular Formula | C17H15N4O2S+ |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | [1H-benzimidazol-2-ylmethylsulfanyl-(3-carboxyanilino)methylidene]-methylideneazanium |
| SMILES | C=[N+]=C(Nc1cccc(C(=O)O)c1)SCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H14N4O2S/c1-18-17(19-12-6-4-5-11(9-12)16(22)23)24-10-15-20-13-7-2-3-8-14(13)21-15/h2-9H,1,10H2,(H2,20,21,22,23)/p+1 |
| InChIKey | FKOJCYISNLRQAB-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 92.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|