C25H42O8 — CID 58861562
4-[2-[4-(2-ethoxyethoxy)-6-(2-propan-2-yloxyethoxy)heptan-2-yl]oxyethoxy]benzoic acid (PubChem CID 58861562) has the molecular formula C25H42O8 and a molecular weight of 470.60 g/mol. Its IUPAC name is 4-[2-[4-(2-ethoxyethoxy)-6-(2-propan-2-yloxyethoxy)heptan-2-yl]oxyethoxy]benzoic acid.
| Compound Name | 4-[2-[4-(2-ethoxyethoxy)-6-(2-propan-2-yloxyethoxy)heptan-2-yl]oxyethoxy]benzoic acid |
|---|---|
| PubChem CID | 58861562 |
| Molecular Formula | C25H42O8 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 4-[2-[4-(2-ethoxyethoxy)-6-(2-propan-2-yloxyethoxy)heptan-2-yl]oxyethoxy]benzoic acid |
| SMILES | CCOCCOC(CC(C)OCCOc1ccc(C(=O)O)cc1)CC(C)OCCOC(C)C |
| InChI | InChI=1S/C25H42O8/c1-6-28-11-12-33-24(17-20(4)30-14-13-29-19(2)3)18-21(5)31-15-16-32-23-9-7-22(8-10-23)25(26)27/h7-10,19-21,24H,6,11-18H2,1-5H3,(H,26,27) |
| InChIKey | YTLIIUXLPSGKBT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|