C8H13F3N3O2S+ — CID 58864684
2-(3-methylimidazol-3-ium-1-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide (PubChem CID 58864684) has the molecular formula C8H13F3N3O2S+ and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 58864684 |
| Molecular Formula | C8H13F3N3O2S+ |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
| SMILES | C[n+]1ccn(CCS(=O)(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C8H13F3N3O2S/c1-13-2-3-14(7-13)4-5-17(15,16)12-6-8(9,10)11/h2-3,7,12H,4-6H2,1H3/q+1 |
| InChIKey | BUSNZCGAUIUGGY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|