C23H29N7O2 — CID 58869621
2-[[4-[2-[(6-amino-2-methyl-3-pyridinyl)methylamino]ethyl]-5-methyl-3-oxopyrazin-2-yl]amino]-3-phenylpropanamide (PubChem CID 58869621) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[[4-[2-[(6-amino-2-methyl-3-pyridinyl)methylamino]ethyl]-5-methyl-3-oxopyrazin-2-yl]amino]-3-phenylpropanamide.
| Compound Name | 2-[[4-[2-[(6-amino-2-methyl-3-pyridinyl)methylamino]ethyl]-5-methyl-3-oxopyrazin-2-yl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 58869621 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 2-[[4-[2-[(6-amino-2-methyl-3-pyridinyl)methylamino]ethyl]-5-methyl-3-oxopyrazin-2-yl]amino]-3-phenylpropanamide |
| SMILES | Cc1nc(N)ccc1CNCCn1c(C)cnc(NC(Cc2ccccc2)C(N)=O)c1=O |
| InChI | InChI=1S/C23H29N7O2/c1-15-13-27-22(29-19(21(25)31)12-17-6-4-3-5-7-17)23(32)30(15)11-10-26-14-18-8-9-20(24)28-16(18)2/h3-9,13,19,26H,10-12,14H2,1-2H3,(H2,24,28)(H2,25,31)(H,27,29) |
| InChIKey | FCMZYXQSLHXXAS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|