C11H24NO5P — CID 58871412
2-(2-methylheptan-2-yloxycarbonylamino)ethylphosphonic acid (PubChem CID 58871412) has the molecular formula C11H24NO5P and a molecular weight of 281.29 g/mol. Its IUPAC name is 2-(2-methylheptan-2-yloxycarbonylamino)ethylphosphonic acid.
| Compound Name | 2-(2-methylheptan-2-yloxycarbonylamino)ethylphosphonic acid |
|---|---|
| PubChem CID | 58871412 |
| Molecular Formula | C11H24NO5P |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(2-methylheptan-2-yloxycarbonylamino)ethylphosphonic acid |
| SMILES | CCCCCC(C)(C)OC(=O)NCCP(=O)(O)O |
| InChI | InChI=1S/C11H24NO5P/c1-4-5-6-7-11(2,3)17-10(13)12-8-9-18(14,15)16/h4-9H2,1-3H3,(H,12,13)(H2,14,15,16) |
| InChIKey | KHIPBYXAGSONHP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|