C14H28N4O7P- — CID 58871698
6-[[1,4-bis(methylamino)-1,4-dioxobutan-2-yl]carbamoylamino]hexyl methyl phosphate (PubChem CID 58871698) has the molecular formula C14H28N4O7P- and a molecular weight of 395.37 g/mol. Its IUPAC name is 6-[[1,4-bis(methylamino)-1,4-dioxobutan-2-yl]carbamoylamino]hexyl methyl phosphate.
| Compound Name | 6-[[1,4-bis(methylamino)-1,4-dioxobutan-2-yl]carbamoylamino]hexyl methyl phosphate |
|---|---|
| PubChem CID | 58871698 |
| Molecular Formula | C14H28N4O7P- |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 6-[[1,4-bis(methylamino)-1,4-dioxobutan-2-yl]carbamoylamino]hexyl methyl phosphate |
| SMILES | CNC(=O)CC(NC(=O)NCCCCCCOP(=O)([O-])OC)C(=O)NC |
| InChI | InChI=1S/C14H29N4O7P/c1-15-12(19)10-11(13(20)16-2)18-14(21)17-8-6-4-5-7-9-25-26(22,23)24-3/h11H,4-10H2,1-3H3,(H,15,19)(H,16,20)(H,22,23)(H2,17,18,21)/p-1 |
| InChIKey | PTIBRSIBVZLIEG-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 157.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|