C11H15F3N2 — CID 58874449
4,5-di(propan-2-yl)-2-(trifluoromethyl)pyrimidine (PubChem CID 58874449) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)-2-(trifluoromethyl)pyrimidine.
| Compound Name | 4,5-di(propan-2-yl)-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 58874449 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4,5-di(propan-2-yl)-2-(trifluoromethyl)pyrimidine |
| SMILES | CC(C)c1cnc(C(F)(F)F)nc1C(C)C |
| InChI | InChI=1S/C11H15F3N2/c1-6(2)8-5-15-10(11(12,13)14)16-9(8)7(3)4/h5-7H,1-4H3 |
| InChIKey | MXYLIJGBHGMARV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |