C27H18F3N3O4S — CID 58874600
2-[[2-phenyl-1-[4-(trifluoromethyl)phenyl]benzimidazol-5-yl]sulfamoyl]benzoic acid (PubChem CID 58874600) has the molecular formula C27H18F3N3O4S and a molecular weight of 537.52 g/mol. Its IUPAC name is 2-[[2-phenyl-1-[4-(trifluoromethyl)phenyl]benzimidazol-5-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-[[2-phenyl-1-[4-(trifluoromethyl)phenyl]benzimidazol-5-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 58874600 |
| Molecular Formula | C27H18F3N3O4S |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 2-[[2-phenyl-1-[4-(trifluoromethyl)phenyl]benzimidazol-5-yl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)Nc1ccc2c(c1)nc(-c1ccccc1)n2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H18F3N3O4S/c28-27(29,30)18-10-13-20(14-11-18)33-23-15-12-19(16-22(23)31-25(33)17-6-2-1-3-7-17)32-38(36,37)24-9-5-4-8-21(24)26(34)35/h1-16,32H,(H,34,35) |
| InChIKey | PLLXIYZLSTZKRV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |