C27H29N5O4S — CID 58874898
3-[3-[3-amino-4-[methyl(3-methylbutyl)amino]phenyl]-1,2,4-oxadiazol-5-yl]-N-(benzenesulfonyl)benzamide (PubChem CID 58874898) has the molecular formula C27H29N5O4S and a molecular weight of 519.63 g/mol. Its IUPAC name is 3-[3-[3-amino-4-[methyl(3-methylbutyl)amino]phenyl]-1,2,4-oxadiazol-5-yl]-N-(benzenesulfonyl)benzamide.
| Compound Name | 3-[3-[3-amino-4-[methyl(3-methylbutyl)amino]phenyl]-1,2,4-oxadiazol-5-yl]-N-(benzenesulfonyl)benzamide |
|---|---|
| PubChem CID | 58874898 |
| Molecular Formula | C27H29N5O4S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 3-[3-[3-amino-4-[methyl(3-methylbutyl)amino]phenyl]-1,2,4-oxadiazol-5-yl]-N-(benzenesulfonyl)benzamide |
| SMILES | CC(C)CCN(C)c1ccc(-c2noc(-c3cccc(C(=O)NS(=O)(=O)c4ccccc4)c3)n2)cc1N |
| InChI | InChI=1S/C27H29N5O4S/c1-18(2)14-15-32(3)24-13-12-19(17-23(24)28)25-29-27(36-30-25)21-9-7-8-20(16-21)26(33)31-37(34,35)22-10-5-4-6-11-22/h4-13,16-18H,14-15,28H2,1-3H3,(H,31,33) |
| InChIKey | AQJQEAXQLYUDJQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|