C29H27N5O8S — CID 58874588
ethyl 1-[4-[3-[3-(benzenesulfonylcarbamoyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-nitrophenyl]piperidine-3-carboxylate (PubChem CID 58874588) has the molecular formula C29H27N5O8S and a molecular weight of 605.63 g/mol. Its IUPAC name is ethyl 1-[4-[3-[3-(benzenesulfonylcarbamoyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-nitrophenyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[4-[3-[3-(benzenesulfonylcarbamoyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-nitrophenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 58874588 |
| Molecular Formula | C29H27N5O8S |
| Molecular Weight | 605.63 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | ethyl 1-[4-[3-[3-(benzenesulfonylcarbamoyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-nitrophenyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ccc(-c3nc(-c4cccc(C(=O)NS(=O)(=O)c5ccccc5)c4)no3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C29H27N5O8S/c1-2-41-29(36)22-10-7-15-33(18-22)24-14-13-21(17-25(24)34(37)38)28-30-26(31-42-28)19-8-6-9-20(16-19)27(35)32-43(39,40)23-11-4-3-5-12-23/h3-6,8-9,11-14,16-17,22H,2,7,10,15,18H2,1H3,(H,32,35) |
| InChIKey | HKDGVHBLCKZUES-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|