C23H22N6O4 — CID 46044954
ethyl 1-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperidine-3-carboxylate (PubChem CID 46044954) has the molecular formula C23H22N6O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is ethyl 1-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46044954 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | ethyl 1-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2nc3ccccc3c3nnc(-c4ccc([N+](=O)[O-])cc4)n23)C1 |
| InChI | InChI=1S/C23H22N6O4/c1-2-33-22(30)16-6-5-13-27(14-16)23-24-19-8-4-3-7-18(19)21-26-25-20(28(21)23)15-9-11-17(12-10-15)29(31)32/h3-4,7-12,16H,2,5-6,13-14H2,1H3 |
| InChIKey | QQFLCPIUMAIAON-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 115.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|