C26H21N7O3 — CID 46158543
[4-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]-phenylmethanone (PubChem CID 46158543) has the molecular formula C26H21N7O3 and a molecular weight of 479.50 g/mol. Its IUPAC name is [4-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 46158543 |
| Molecular Formula | C26H21N7O3 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [4-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(c2nc3ccccc3c3nnc(-c4ccc([N+](=O)[O-])cc4)n23)CC1 |
| InChI | InChI=1S/C26H21N7O3/c34-25(19-6-2-1-3-7-19)30-14-16-31(17-15-30)26-27-22-9-5-4-8-21(22)24-29-28-23(32(24)26)18-10-12-20(13-11-18)33(35)36/h1-13H,14-17H2 |
| InChIKey | FFJVIFDFJAWVRY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|