C25H27N7O3 — CID 46064032
3,3-dimethyl-1-[4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]butan-1-one (PubChem CID 46064032) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 3,3-dimethyl-1-[4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]butan-1-one.
| Compound Name | 3,3-dimethyl-1-[4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 46064032 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 3,3-dimethyl-1-[4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]butan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCN(c2nc3ccccc3c3nnc(-c4ccccc4[N+](=O)[O-])n23)CC1 |
| InChI | InChI=1S/C25H27N7O3/c1-25(2,3)16-21(33)29-12-14-30(15-13-29)24-26-19-10-6-4-8-17(19)22-27-28-23(31(22)24)18-9-5-7-11-20(18)32(34)35/h4-11H,12-16H2,1-3H3 |
| InChIKey | WCYXDXDKEHTTLU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|