C18H16N6O2 — CID 46063497
N-ethyl-N-methyl-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-amine (PubChem CID 46063497) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is N-ethyl-N-methyl-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-amine.
| Compound Name | N-ethyl-N-methyl-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-amine |
|---|---|
| PubChem CID | 46063497 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-ethyl-N-methyl-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-amine |
| SMILES | CCN(C)c1nc2ccccc2c2nnc(-c3ccccc3[N+](=O)[O-])n12 |
| InChI | InChI=1S/C18H16N6O2/c1-3-22(2)18-19-14-10-6-4-8-12(14)16-20-21-17(23(16)18)13-9-5-7-11-15(13)24(25)26/h4-11H,3H2,1-2H3 |
| InChIKey | QWAFPDMZYVLMEK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|