C22H22N6O3 — CID 42864436
2,6-dimethyl-4-[9-methyl-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]morpholine (PubChem CID 42864436) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2,6-dimethyl-4-[9-methyl-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]morpholine.
| Compound Name | 2,6-dimethyl-4-[9-methyl-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]morpholine |
|---|---|
| PubChem CID | 42864436 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2,6-dimethyl-4-[9-methyl-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]morpholine |
| SMILES | Cc1ccc2nc(N3CC(C)OC(C)C3)n3c(-c4ccccc4[N+](=O)[O-])nnc3c2c1 |
| InChI | InChI=1S/C22H22N6O3/c1-13-8-9-18-17(10-13)21-25-24-20(16-6-4-5-7-19(16)28(29)30)27(21)22(23-18)26-11-14(2)31-15(3)12-26/h4-10,14-15H,11-12H2,1-3H3 |
| InChIKey | YFKJYPDUFGKTMH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|