C25H23N7O3 — CID 92994273
3-(furan-2-yl)-5-[(3S)-3-methyl-4-[(2-nitrophenyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline (PubChem CID 92994273) has the molecular formula C25H23N7O3 and a molecular weight of 469.51 g/mol. Its IUPAC name is 3-(furan-2-yl)-5-[(3S)-3-methyl-4-[(2-nitrophenyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline.
| Compound Name | 3-(furan-2-yl)-5-[(3S)-3-methyl-4-[(2-nitrophenyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline |
|---|---|
| PubChem CID | 92994273 |
| Molecular Formula | C25H23N7O3 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 3-(furan-2-yl)-5-[(3S)-3-methyl-4-[(2-nitrophenyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline |
| SMILES | C[C@H]1CN(c2nc3ccccc3c3nnc(-c4ccco4)n23)CCN1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H23N7O3/c1-17-15-30(13-12-29(17)16-18-7-2-5-10-21(18)32(33)34)25-26-20-9-4-3-8-19(20)23-27-28-24(31(23)25)22-11-6-14-35-22/h2-11,14,17H,12-13,15-16H2,1H3/t17-/m0/s1 |
| InChIKey | OJBGQKSSKZWPEV-KRWDZBQOSA-N |
| XLogP | 4.16 |
| TPSA | 105.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|