C17H18N6O2 — CID 124591652
3-[(3R)-3-methyl-4-[(2-nitrophenyl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 124591652) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 3-[(3R)-3-methyl-4-[(2-nitrophenyl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[(3R)-3-methyl-4-[(2-nitrophenyl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 124591652 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3-[(3R)-3-methyl-4-[(2-nitrophenyl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | C[C@@H]1CN(c2nccnc2C#N)CCN1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N6O2/c1-13-11-22(17-15(10-18)19-6-7-20-17)9-8-21(13)12-14-4-2-3-5-16(14)23(24)25/h2-7,13H,8-9,11-12H2,1H3/t13-/m1/s1 |
| InChIKey | HBZDXWWNCLQANC-CYBMUJFWSA-N |
| XLogP | 1.97 |
| TPSA | 99.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|