C12H15F3N4O2 — CID 133431499
2-methyl-4-(3-nitro-2-pyridinyl)-1-(2,2,2-trifluoroethyl)piperazine (PubChem CID 133431499) has the molecular formula C12H15F3N4O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is 2-methyl-4-(3-nitro-2-pyridinyl)-1-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 2-methyl-4-(3-nitro-2-pyridinyl)-1-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 133431499 |
| Molecular Formula | C12H15F3N4O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-methyl-4-(3-nitro-2-pyridinyl)-1-(2,2,2-trifluoroethyl)piperazine |
| SMILES | CC1CN(c2ncccc2[N+](=O)[O-])CCN1CC(F)(F)F |
| InChI | InChI=1S/C12H15F3N4O2/c1-9-7-17(5-6-18(9)8-12(13,14)15)11-10(19(20)21)3-2-4-16-11/h2-4,9H,5-8H2,1H3 |
| InChIKey | GSBNNMRMPSPPJE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|