C14H18F3N3O2 — CID 133431429
2-methyl-4-(3-methyl-4-nitrophenyl)-1-(2,2,2-trifluoroethyl)piperazine (PubChem CID 133431429) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is 2-methyl-4-(3-methyl-4-nitrophenyl)-1-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 2-methyl-4-(3-methyl-4-nitrophenyl)-1-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 133431429 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-methyl-4-(3-methyl-4-nitrophenyl)-1-(2,2,2-trifluoroethyl)piperazine |
| SMILES | Cc1cc(N2CCN(CC(F)(F)F)C(C)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18F3N3O2/c1-10-7-12(3-4-13(10)20(21)22)18-5-6-19(11(2)8-18)9-14(15,16)17/h3-4,7,11H,5-6,8-9H2,1-2H3 |
| InChIKey | JHIPTPFOOIHTAG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|