C27H22ClN7O3 — CID 42864786
(4-chlorophenyl)-[2-methyl-4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]methanone (PubChem CID 42864786) has the molecular formula C27H22ClN7O3 and a molecular weight of 527.97 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-methyl-4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[2-methyl-4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42864786 |
| Molecular Formula | C27H22ClN7O3 |
| Molecular Weight | 527.97 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | (4-chlorophenyl)-[2-methyl-4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]methanone |
| SMILES | CC1CN(c2nc3ccccc3c3nnc(-c4ccccc4[N+](=O)[O-])n23)CCN1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22ClN7O3/c1-17-16-32(14-15-33(17)26(36)18-10-12-19(28)13-11-18)27-29-22-8-4-2-6-20(22)24-30-31-25(34(24)27)21-7-3-5-9-23(21)35(37)38/h2-13,17H,14-16H2,1H3 |
| InChIKey | IOYZYKOUBUTZQS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|