C22H21N7O4 — CID 46064035
2-methoxy-1-[4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]ethanone (PubChem CID 46064035) has the molecular formula C22H21N7O4 and a molecular weight of 447.46 g/mol. Its IUPAC name is 2-methoxy-1-[4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46064035 |
| Molecular Formula | C22H21N7O4 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-methoxy-1-[4-[3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl]ethanone |
| SMILES | COCC(=O)N1CCN(c2nc3ccccc3c3nnc(-c4ccccc4[N+](=O)[O-])n23)CC1 |
| InChI | InChI=1S/C22H21N7O4/c1-33-14-19(30)26-10-12-27(13-11-26)22-23-17-8-4-2-6-15(17)20-24-25-21(28(20)22)16-7-3-5-9-18(16)29(31)32/h2-9H,10-14H2,1H3 |
| InChIKey | UEBSNYMLYTVYMJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 119.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|