C23H21ClN6O4 — CID 42864342
ethyl 1-[8-chloro-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperidine-4-carboxylate (PubChem CID 42864342) has the molecular formula C23H21ClN6O4 and a molecular weight of 480.91 g/mol. Its IUPAC name is ethyl 1-[8-chloro-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[8-chloro-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42864342 |
| Molecular Formula | C23H21ClN6O4 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | ethyl 1-[8-chloro-3-(2-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc3cc(Cl)ccc3c3nnc(-c4ccccc4[N+](=O)[O-])n23)CC1 |
| InChI | InChI=1S/C23H21ClN6O4/c1-2-34-22(31)14-9-11-28(12-10-14)23-25-18-13-15(24)7-8-16(18)20-26-27-21(29(20)23)17-5-3-4-6-19(17)30(32)33/h3-8,13-14H,2,9-12H2,1H3 |
| InChIKey | KSHCAXHMSTYZIN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 115.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|