C27H22F3N7O2 — CID 42865048
3-(2-nitrophenyl)-5-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline (PubChem CID 42865048) has the molecular formula C27H22F3N7O2 and a molecular weight of 533.51 g/mol. Its IUPAC name is 3-(2-nitrophenyl)-5-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline.
| Compound Name | 3-(2-nitrophenyl)-5-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline |
|---|---|
| PubChem CID | 42865048 |
| Molecular Formula | C27H22F3N7O2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 3-(2-nitrophenyl)-5-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline |
| SMILES | O=[N+]([O-])c1ccccc1-c1nnc2c3ccccc3nc(N3CCN(Cc4ccc(C(F)(F)F)cc4)CC3)n12 |
| InChI | InChI=1S/C27H22F3N7O2/c28-27(29,30)19-11-9-18(10-12-19)17-34-13-15-35(16-14-34)26-31-22-7-3-1-5-20(22)24-32-33-25(36(24)26)21-6-2-4-8-23(21)37(38)39/h1-12H,13-17H2 |
| InChIKey | ULBZZMVYFNXIKV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|