C25H21N7O4 — CID 92993760
[(2R)-4-[3-(furan-2-yl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]-2-methylpiperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 92993760) has the molecular formula C25H21N7O4 and a molecular weight of 483.49 g/mol. Its IUPAC name is [(2R)-4-[3-(furan-2-yl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]-2-methylpiperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(2R)-4-[3-(furan-2-yl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]-2-methylpiperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 92993760 |
| Molecular Formula | C25H21N7O4 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | [(2R)-4-[3-(furan-2-yl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]-2-methylpiperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | C[C@@H]1CN(c2nc3ccccc3c3nnc(-c4ccco4)n23)CCN1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H21N7O4/c1-16-15-29(12-13-30(16)24(33)17-8-10-18(11-9-17)32(34)35)25-26-20-6-3-2-5-19(20)22-27-28-23(31(22)25)21-7-4-14-36-21/h2-11,14,16H,12-13,15H2,1H3/t16-/m1/s1 |
| InChIKey | MENMIJAKFLBTED-MRXNPFEDSA-N |
| XLogP | 3.80 |
| TPSA | 122.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|