C19H19N7O2 — CID 42864608
N',N'-dimethyl-N-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]ethane-1,2-diamine (PubChem CID 42864608) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is N',N'-dimethyl-N-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 42864608 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N',N'-dimethyl-N-[3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-yl]ethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc2ccccc2c2nnc(-c3ccc([N+](=O)[O-])cc3)n12 |
| InChI | InChI=1S/C19H19N7O2/c1-24(2)12-11-20-19-21-16-6-4-3-5-15(16)18-23-22-17(25(18)19)13-7-9-14(10-8-13)26(27)28/h3-10H,11-12H2,1-2H3,(H,20,21) |
| InChIKey | KMXXBUIMSSELJF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|