C16H15N5O2 — CID 42864610
3-(furan-2-yl)-N-(2-methoxyethyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-amine (PubChem CID 42864610) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(2-methoxyethyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-amine.
| Compound Name | 3-(furan-2-yl)-N-(2-methoxyethyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-amine |
|---|---|
| PubChem CID | 42864610 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-(furan-2-yl)-N-(2-methoxyethyl)-[1,2,4]triazolo[4,3-c]quinazolin-5-amine |
| SMILES | COCCNc1nc2ccccc2c2nnc(-c3ccco3)n12 |
| InChI | InChI=1S/C16H15N5O2/c1-22-10-8-17-16-18-12-6-3-2-5-11(12)14-19-20-15(21(14)16)13-7-4-9-23-13/h2-7,9H,8,10H2,1H3,(H,17,18) |
| InChIKey | QZJUVJPTWHEDDO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|