C23H23N7O3 — CID 42864809
(4-methyl-3-nitrophenyl)-[4-(3-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)-1,4-diazepan-1-yl]methanone (PubChem CID 42864809) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is (4-methyl-3-nitrophenyl)-[4-(3-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (4-methyl-3-nitrophenyl)-[4-(3-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 42864809 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (4-methyl-3-nitrophenyl)-[4-(3-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCCN(c3nc4ccccc4c4nnc(C)n34)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23N7O3/c1-15-8-9-17(14-20(15)30(32)33)22(31)27-10-5-11-28(13-12-27)23-24-19-7-4-3-6-18(19)21-26-25-16(2)29(21)23/h3-4,6-9,14H,5,10-13H2,1-2H3 |
| InChIKey | MUEMVTJYAFIJOM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|