C27H23N7O3 — CID 42864767
[4-(3-benzyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 42864767) has the molecular formula C27H23N7O3 and a molecular weight of 493.53 g/mol. Its IUPAC name is [4-(3-benzyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-(3-benzyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42864767 |
| Molecular Formula | C27H23N7O3 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | [4-(3-benzyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCN(c2nc3ccccc3c3nnc(Cc4ccccc4)n23)CC1 |
| InChI | InChI=1S/C27H23N7O3/c35-26(20-10-12-21(13-11-20)34(36)37)31-14-16-32(17-15-31)27-28-23-9-5-4-8-22(23)25-30-29-24(33(25)27)18-19-6-2-1-3-7-19/h1-13H,14-18H2 |
| InChIKey | DCVICRCCOGLXKB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|