C29H29FN6O3 — CID 58877100
3-[3-ethyl-4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]anilino]-5-(3-hydroxyphenyl)phenol (PubChem CID 58877100) has the molecular formula C29H29FN6O3 and a molecular weight of 528.59 g/mol. Its IUPAC name is 3-[3-ethyl-4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]anilino]-5-(3-hydroxyphenyl)phenol.
| Compound Name | 3-[3-ethyl-4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]anilino]-5-(3-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 58877100 |
| Molecular Formula | C29H29FN6O3 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 3-[3-ethyl-4-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]anilino]-5-(3-hydroxyphenyl)phenol |
| SMILES | CCc1cc(Nc2cc(O)cc(-c3cccc(O)c3)c2)ccc1/C=N/Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C29H29FN6O3/c1-2-19-12-23(33-24-13-22(15-26(38)16-24)20-4-3-5-25(37)14-20)7-6-21(19)17-32-35-29-31-18-27(30)28(34-29)36-8-10-39-11-9-36/h3-7,12-18,33,37-38H,2,8-11H2,1H3,(H,31,34,35)/b32-17+ |
| InChIKey | WCCDSYHAPYDADU-VTNSRFBWSA-N |
| XLogP | 5.28 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|