C19H20FNO3 — CID 58878798
(4R)-2,2,3,3,4,6,6-heptadeuterio-5-[(2,2-dideuterio-1,3-benzodioxol-5-yl)oxymethyl]-4-(2,3,5,6-tetradeuterio-4-fluorophenyl)piperidine (PubChem CID 58878798) has the molecular formula C19H20FNO3 and a molecular weight of 342.45 g/mol. Its IUPAC name is (4R)-2,2,3,3,4,6,6-heptadeuterio-5-[(2,2-dideuterio-1,3-benzodioxol-5-yl)oxymethyl]-4-(2,3,5,6-tetradeuterio-4-fluorophenyl)piperidine.
| Compound Name | (4R)-2,2,3,3,4,6,6-heptadeuterio-5-[(2,2-dideuterio-1,3-benzodioxol-5-yl)oxymethyl]-4-(2,3,5,6-tetradeuterio-4-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 58878798 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (4R)-2,2,3,3,4,6,6-heptadeuterio-5-[(2,2-dideuterio-1,3-benzodioxol-5-yl)oxymethyl]-4-(2,3,5,6-tetradeuterio-4-fluorophenyl)piperidine |
| SMILES | [2H]c1c([2H])c([C@@]2([2H])C(COc3ccc4c(c3)OC([2H])([2H])O4)C([2H])([2H])NC([2H])([2H])C2([2H])[2H])c([2H])c([2H])c1F |
| InChI | InChI=1S/C19H20FNO3/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18/h1-6,9,14,17,21H,7-8,10-12H2/t14?,17-/m0/s1/i1D,2D,3D,4D,7D2,8D2,10D2,12D2,17D |
| InChIKey | AHOUBRCZNHFOSL-HJISFPSRSA-N |
| XLogP | 3.33 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |