C19H17N3OS — CID 58878931
6-[4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]pyridine-3-carbonitrile (PubChem CID 58878931) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 6-[4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58878931 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 6-[4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(CNCCc3cccs3)cc2)nc1 |
| InChI | InChI=1S/C19H17N3OS/c20-12-16-5-8-19(22-14-16)23-17-6-3-15(4-7-17)13-21-10-9-18-2-1-11-24-18/h1-8,11,14,21H,9-10,13H2 |
| InChIKey | SQGYVGJUCQRMDY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|