About methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate
methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate (PubChem CID 58880174) has the molecular formula C14H10FN3O6
and a molecular weight of 335.25 g/mol. Its IUPAC name is methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate.
Molecular Properties
| Compound Name | methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate |
| PubChem CID | 58880174 |
| Molecular Formula | C14H10FN3O6 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(-c2cc(C)cnc2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10FN3O6/c1-7-3-9(13(15)16-6-7)12-10(17(20)21)4-8(14(19)24-2)5-11(12)18(22)23/h3-6H,1-2H3 |
| InChIKey | MAIMMXPNLFFCDC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 125.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate?
The IUPAC name of methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate (CID 58880174) is methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate.
What is the SMILES notation for methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate?
The canonical SMILES for methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate is COC(=O)c1cc([N+](=O)[O-])c(-c2cc(C)cnc2F)c([N+](=O)[O-])c1.
What is the InChIKey of methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate?
The InChIKey is MAIMMXPNLFFCDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN3O6/c1-7-3-9(13(15)16-6-7)12-10(17(20)21)4-8(14(19)24-2)5-11(12)18(22)23/h3-6H,1-2H3.
What are the key properties of methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate?
methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate has a molecular weight of 335.25 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrobenzoate is sourced from PubChem (CID 58880174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).