About methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane
methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane (PubChem CID 143984971) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane.
Molecular Properties
| Compound Name | methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane |
| PubChem CID | 143984971 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane |
| SMILES | CC(C)C.COC(=O)c1cnc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H7N3O4.C4H10/c1-14-7(11)4-2-5(10(12)13)6(8)9-3-4;1-4(2)3/h2-3H,1H3,(H2,8,9);4H,1-3H3 |
| InChIKey | SKEXINHVTYPCMZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane?
The IUPAC name of methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane (CID 143984971) is methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane.
What is the SMILES notation for methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane?
The canonical SMILES for methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane is CC(C)C.COC(=O)c1cnc(N)c([N+](=O)[O-])c1.
What is the InChIKey of methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane?
The InChIKey is SKEXINHVTYPCMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O4.C4H10/c1-14-7(11)4-2-5(10(12)13)6(8)9-3-4;1-4(2)3/h2-3H,1H3,(H2,8,9);4H,1-3H3.
What are the key properties of methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane?
methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane has a molecular weight of 255.27 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-amino-5-nitropyridine-3-carboxylate;2-methylpropane is sourced from PubChem (CID 143984971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).