C7H9BN2O5 — CID 169224427
(2-amino-5-methoxycarbonyl-3-pyridinyl)oxyboronic acid (PubChem CID 169224427) has the molecular formula C7H9BN2O5 and a molecular weight of 211.97 g/mol. Its IUPAC name is (2-amino-5-methoxycarbonyl-3-pyridinyl)oxyboronic acid.
| Compound Name | (2-amino-5-methoxycarbonyl-3-pyridinyl)oxyboronic acid |
|---|---|
| PubChem CID | 169224427 |
| Molecular Formula | C7H9BN2O5 |
| Molecular Weight | 211.97 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (2-amino-5-methoxycarbonyl-3-pyridinyl)oxyboronic acid |
| SMILES | COC(=O)c1cnc(N)c(OB(O)O)c1 |
| InChI | InChI=1S/C7H9BN2O5/c1-14-7(11)4-2-5(15-8(12)13)6(9)10-3-4/h2-3,12-13H,1H3,(H2,9,10) |
| InChIKey | URDIDDZQFUSTQN-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.97 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|