C11H11BrN2O2 — CID 170466695
methyl 6-amino-5-(4-bromobut-1-ynyl)pyridine-3-carboxylate (PubChem CID 170466695) has the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. Its IUPAC name is methyl 6-amino-5-(4-bromobut-1-ynyl)pyridine-3-carboxylate.
| Compound Name | methyl 6-amino-5-(4-bromobut-1-ynyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170466695 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | methyl 6-amino-5-(4-bromobut-1-ynyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(N)c(C#CCCBr)c1 |
| InChI | InChI=1S/C11H11BrN2O2/c1-16-11(15)9-6-8(4-2-3-5-12)10(13)14-7-9/h6-7H,3,5H2,1H3,(H2,13,14) |
| InChIKey | KINMOLBNVLMWLZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|