C16H10BrCl3N2OS — CID 58880293
5-(5-bromothiophen-2-yl)-1-(2,4-dichlorophenyl)-4-ethylpyrazole-3-carbonyl chloride (PubChem CID 58880293) has the molecular formula C16H10BrCl3N2OS and a molecular weight of 464.60 g/mol. Its IUPAC name is 5-(5-bromothiophen-2-yl)-1-(2,4-dichlorophenyl)-4-ethylpyrazole-3-carbonyl chloride.
| Compound Name | 5-(5-bromothiophen-2-yl)-1-(2,4-dichlorophenyl)-4-ethylpyrazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 58880293 |
| Molecular Formula | C16H10BrCl3N2OS |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 461.88 |
| IUPAC Name | 5-(5-bromothiophen-2-yl)-1-(2,4-dichlorophenyl)-4-ethylpyrazole-3-carbonyl chloride |
| SMILES | CCc1c(C(=O)Cl)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Br)s1 |
| InChI | InChI=1S/C16H10BrCl3N2OS/c1-2-9-14(16(20)23)21-22(11-4-3-8(18)7-10(11)19)15(9)12-5-6-13(17)24-12/h3-7H,2H2,1H3 |
| InChIKey | HDZIIUBOTZUUMF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|