C17H13BrCl2N2O3S2 — CID 151246039
2-[5-(5-bromothiophen-2-yl)-1-(2,4-dichlorophenyl)-4-ethylpyrazol-3-yl]ethenesulfonic acid (PubChem CID 151246039) has the molecular formula C17H13BrCl2N2O3S2 and a molecular weight of 508.25 g/mol. Its IUPAC name is 2-[5-(5-bromothiophen-2-yl)-1-(2,4-dichlorophenyl)-4-ethylpyrazol-3-yl]ethenesulfonic acid.
| Compound Name | 2-[5-(5-bromothiophen-2-yl)-1-(2,4-dichlorophenyl)-4-ethylpyrazol-3-yl]ethenesulfonic acid |
|---|---|
| PubChem CID | 151246039 |
| Molecular Formula | C17H13BrCl2N2O3S2 |
| Molecular Weight | 508.25 g/mol |
| Exact Mass | 505.89 |
| IUPAC Name | 2-[5-(5-bromothiophen-2-yl)-1-(2,4-dichlorophenyl)-4-ethylpyrazol-3-yl]ethenesulfonic acid |
| SMILES | CCc1c(C=CS(=O)(=O)O)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Br)s1 |
| InChI | InChI=1S/C17H13BrCl2N2O3S2/c1-2-11-13(7-8-27(23,24)25)21-22(14-4-3-10(19)9-12(14)20)17(11)15-5-6-16(18)26-15/h3-9H,2H2,1H3,(H,23,24,25) |
| InChIKey | NRIFFSLEZPOJGE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.25 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|