C37H28Cl4N4O3S3 — CID 123671965
1-(2,4-dichlorophenyl)-3-[7-[1-(2,4-dichlorophenyl)-4,5-dihydrothieno[3,2-g]indazol-3-yl]hepta-1,6-dienyl]-4,5-dihydrothieno[3,2-g]indazole-7-sulfonic acid (PubChem CID 123671965) has the molecular formula C37H28Cl4N4O3S3 and a molecular weight of 814.67 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[7-[1-(2,4-dichlorophenyl)-4,5-dihydrothieno[3,2-g]indazol-3-yl]hepta-1,6-dienyl]-4,5-dihydrothieno[3,2-g]indazole-7-sulfonic acid.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[7-[1-(2,4-dichlorophenyl)-4,5-dihydrothieno[3,2-g]indazol-3-yl]hepta-1,6-dienyl]-4,5-dihydrothieno[3,2-g]indazole-7-sulfonic acid |
|---|---|
| PubChem CID | 123671965 |
| Molecular Formula | C37H28Cl4N4O3S3 |
| Molecular Weight | 814.67 g/mol |
| Exact Mass | 812.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[7-[1-(2,4-dichlorophenyl)-4,5-dihydrothieno[3,2-g]indazol-3-yl]hepta-1,6-dienyl]-4,5-dihydrothieno[3,2-g]indazole-7-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc2c(s1)-c1c(c(C=CCCCC=Cc3nn(-c4ccc(Cl)cc4Cl)c4c3CCc3ccsc3-4)nn1-c1ccc(Cl)cc1Cl)CC2 |
| InChI | InChI=1S/C37H28Cl4N4O3S3/c38-23-10-14-31(27(40)19-23)44-34-25(12-8-21-16-17-49-36(21)34)29(42-44)6-4-2-1-3-5-7-30-26-13-9-22-18-33(51(46,47)48)50-37(22)35(26)45(43-30)32-15-11-24(39)20-28(32)41/h4-7,10-11,14-20H,1-3,8-9,12-13H2,(H,46,47,48) |
| InChIKey | AFEZQRGIBGXYKJ-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.67 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|