C31H20Cl4N6O7S4 — CID 86298178
1-(2,4-dichlorophenyl)-3-[[1-(2,4-dichlorophenyl)-7-sulfo-4,5-dihydrothieno[3,2-g]indazol-3-yl]carbamoylamino]-4,5-dihydrothieno[3,2-g]indazole-7-sulfonic acid (PubChem CID 86298178) has the molecular formula C31H20Cl4N6O7S4 and a molecular weight of 858.62 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[[1-(2,4-dichlorophenyl)-7-sulfo-4,5-dihydrothieno[3,2-g]indazol-3-yl]carbamoylamino]-4,5-dihydrothieno[3,2-g]indazole-7-sulfonic acid.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[[1-(2,4-dichlorophenyl)-7-sulfo-4,5-dihydrothieno[3,2-g]indazol-3-yl]carbamoylamino]-4,5-dihydrothieno[3,2-g]indazole-7-sulfonic acid |
|---|---|
| PubChem CID | 86298178 |
| Molecular Formula | C31H20Cl4N6O7S4 |
| Molecular Weight | 858.62 g/mol |
| Exact Mass | 855.90 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[[1-(2,4-dichlorophenyl)-7-sulfo-4,5-dihydrothieno[3,2-g]indazol-3-yl]carbamoylamino]-4,5-dihydrothieno[3,2-g]indazole-7-sulfonic acid |
| SMILES | O=C(Nc1nn(-c2ccc(Cl)cc2Cl)c2c1CCc1cc(S(=O)(=O)O)sc1-2)Nc1nn(-c2ccc(Cl)cc2Cl)c2c1CCc1cc(S(=O)(=O)O)sc1-2 |
| InChI | InChI=1S/C31H20Cl4N6O7S4/c32-15-3-7-21(19(34)11-15)40-25-17(5-1-13-9-23(49-27(13)25)51(43,44)45)29(38-40)36-31(42)37-30-18-6-2-14-10-24(52(46,47)48)50-28(14)26(18)41(39-30)22-8-4-16(33)12-20(22)35/h3-4,7-12H,1-2,5-6H2,(H,43,44,45)(H,46,47,48)(H2,36,37,38,39,42) |
| InChIKey | WTLPHEUCKNZXIH-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.62 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|