C15H24O2 — CID 58881473
pentyl 3,7-dimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate (PubChem CID 58881473) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is pentyl 3,7-dimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate.
| Compound Name | pentyl 3,7-dimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate |
|---|---|
| PubChem CID | 58881473 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | pentyl 3,7-dimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate |
| SMILES | CCCCCOC(=O)C12C(C)C3CC1C2C3C |
| InChI | InChI=1S/C15H24O2/c1-4-5-6-7-17-14(16)15-10(3)11-8-12(15)13(15)9(11)2/h9-13H,4-8H2,1-3H3 |
| InChIKey | SUZFODNAVRGRPA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|