C32H22BrN5 — CID 58882313
N-[(5-bromo-1H-indol-3-yl)methyl]-2-(1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine (PubChem CID 58882313) has the molecular formula C32H22BrN5 and a molecular weight of 556.47 g/mol. Its IUPAC name is N-[(5-bromo-1H-indol-3-yl)methyl]-2-(1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine.
| Compound Name | N-[(5-bromo-1H-indol-3-yl)methyl]-2-(1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine |
|---|---|
| PubChem CID | 58882313 |
| Molecular Formula | C32H22BrN5 |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | N-[(5-bromo-1H-indol-3-yl)methyl]-2-(1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-amine |
| SMILES | Brc1ccc2[nH]cc(CNc3ccc4c5ccccc5c5[nH]c(-c6c[nH]c7ccccc67)nc5c4c3)c2c1 |
| InChI | InChI=1S/C32H22BrN5/c33-19-9-12-29-25(13-19)18(16-35-29)15-34-20-10-11-22-21-5-1-2-7-24(21)30-31(26(22)14-20)38-32(37-30)27-17-36-28-8-4-3-6-23(27)28/h1-14,16-17,34-36H,15H2,(H,37,38) |
| InChIKey | MGIGELNKFNKRMZ-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|