C17H25F3O6SSe — CID 58884115
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-[2-(trifluoromethylsulfonyl)ethylselanylmethyl]benzene (PubChem CID 58884115) has the molecular formula C17H25F3O6SSe and a molecular weight of 493.40 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-[2-(trifluoromethylsulfonyl)ethylselanylmethyl]benzene.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-[2-(trifluoromethylsulfonyl)ethylselanylmethyl]benzene |
|---|---|
| PubChem CID | 58884115 |
| Molecular Formula | C17H25F3O6SSe |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-[2-(trifluoromethylsulfonyl)ethylselanylmethyl]benzene |
| SMILES | COCCOCCOCCOc1ccc(C[Se]CCS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H25F3O6SSe/c1-23-6-7-24-8-9-25-10-11-26-16-4-2-15(3-5-16)14-28-13-12-27(21,22)17(18,19)20/h2-5H,6-14H2,1H3 |
| InChIKey | KGIHZYHHNCAAHV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|