C10H10N2S — CID 58884869
2-ethyl-5-phenyl-1,3,4-thiadiazole (PubChem CID 58884869) has the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-ethyl-5-phenyl-1,3,4-thiadiazole.
| Compound Name | 2-ethyl-5-phenyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58884869 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-ethyl-5-phenyl-1,3,4-thiadiazole |
| SMILES | CCc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C10H10N2S/c1-2-9-11-12-10(13-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | DQRWDRSRCOJCDU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |