About cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate
cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate (PubChem CID 58885212) has the molecular formula C26H25NO2
and a molecular weight of 383.49 g/mol. Its IUPAC name is cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate |
| PubChem CID | 58885212 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CC[C@@H](N=C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H25NO2/c28-26(29-19-20-10-4-1-5-11-20)23-16-17-24(18-23)27-25(21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,23-24H,16-19H2/t23-,24+/m0/s1 |
| InChIKey | WDQLFGHWASGAQC-BJKOFHAPSA-N |
| XLogP | 5.44 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate?
The IUPAC name of cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate (CID 58885212) is cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate.
What is the SMILES notation for cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate?
The canonical SMILES for cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate is O=C(OCc1ccccc1)[C@H]1CC[C@@H](N=C(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate?
The InChIKey is WDQLFGHWASGAQC-BJKOFHAPSA-N. The full InChI is InChI=1S/C26H25NO2/c28-26(29-19-20-10-4-1-5-11-20)23-16-17-24(18-23)27-25(21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,23-24H,16-19H2/t23-,24+/m0/s1.
What are the key properties of cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate?
cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate has a molecular weight of 383.49 g/mol, XLogP of 5.44, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-benzyl (1S,3R)-3-(benzhydrylideneamino)cyclopentane-1-carboxylate is sourced from PubChem (CID 58885212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).