C10H18O7 — CID 58890568
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,3,4,5-tetrahydroxypentanal (PubChem CID 58890568) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 58890568 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,3,4,5-tetrahydroxypentanal |
| SMILES | CC1(C)OCC(C(O)C(O)C(O)C(O)C=O)O1 |
| InChI | InChI=1S/C10H18O7/c1-10(2)16-4-6(17-10)8(14)9(15)7(13)5(12)3-11/h3,5-9,12-15H,4H2,1-2H3 |
| InChIKey | UJNGBSBMVLSDMW-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|