C36H24N8 — CID 58895005
8-N,8-N,11-N,11-N-tetrapyridin-4-ylbenzo[a]phenazine-8,11-diamine (PubChem CID 58895005) has the molecular formula C36H24N8 and a molecular weight of 568.64 g/mol. Its IUPAC name is 8-N,8-N,11-N,11-N-tetrapyridin-4-ylbenzo[a]phenazine-8,11-diamine.
| Compound Name | 8-N,8-N,11-N,11-N-tetrapyridin-4-ylbenzo[a]phenazine-8,11-diamine |
|---|---|
| PubChem CID | 58895005 |
| Molecular Formula | C36H24N8 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 8-N,8-N,11-N,11-N-tetrapyridin-4-ylbenzo[a]phenazine-8,11-diamine |
| SMILES | c1ccc2c(c1)ccc1nc3c(N(c4ccncc4)c4ccncc4)ccc(N(c4ccncc4)c4ccncc4)c3nc12 |
| InChI | InChI=1S/C36H24N8/c1-2-4-30-25(3-1)5-6-31-34(30)42-36-33(44(28-13-21-39-22-14-28)29-15-23-40-24-16-29)8-7-32(35(36)41-31)43(26-9-17-37-18-10-26)27-11-19-38-20-12-27/h1-24H |
| InChIKey | CHECTUDCUKURDI-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 83.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|