C24H23N7O2 — CID 58895141
4-[[4-[4-(dimethylamino)pyridin-1-ium-1-yl]-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 58895141) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 4-[[4-[4-(dimethylamino)pyridin-1-ium-1-yl]-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | 4-[[4-[4-(dimethylamino)pyridin-1-ium-1-yl]-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 58895141 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-[[4-[4-(dimethylamino)pyridin-1-ium-1-yl]-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | Cc1ccc(Nc2nc(Nc3ccc(C(=O)[O-])cc3)nc(-[n+]3ccc(N(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C24H23N7O2/c1-16-4-8-18(9-5-16)25-22-27-23(26-19-10-6-17(7-11-19)21(32)33)29-24(28-22)31-14-12-20(13-15-31)30(2)3/h4-15H,1-3H3,(H2-,25,26,27,28,29,32,33) |
| InChIKey | DMCAYXOJTBXWLU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|