C13H12N2O8 — CID 58895384
5-[2-(1,3-dimethoxy-1,3-dioxopropan-2-ylidene)hydrazinyl]benzene-1,3-dicarboxylic acid (PubChem CID 58895384) has the molecular formula C13H12N2O8 and a molecular weight of 324.25 g/mol. Its IUPAC name is 5-[2-(1,3-dimethoxy-1,3-dioxopropan-2-ylidene)hydrazinyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[2-(1,3-dimethoxy-1,3-dioxopropan-2-ylidene)hydrazinyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 58895384 |
| Molecular Formula | C13H12N2O8 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 5-[2-(1,3-dimethoxy-1,3-dioxopropan-2-ylidene)hydrazinyl]benzene-1,3-dicarboxylic acid |
| SMILES | COC(=O)C(=NNc1cc(C(=O)O)cc(C(=O)O)c1)C(=O)OC |
| InChI | InChI=1S/C13H12N2O8/c1-22-12(20)9(13(21)23-2)15-14-8-4-6(10(16)17)3-7(5-8)11(18)19/h3-5,14H,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | GGTRTSIIXDEZQB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 151.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|